C23H26N4O4 — CID 136628684
1-cyclopentyl-3-[7-[4-hydroxy-3-(2-methoxyethoxy)phenyl]-1,5-naphthyridin-2-yl]urea (PubChem CID 136628684) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 1-cyclopentyl-3-[7-[4-hydroxy-3-(2-methoxyethoxy)phenyl]-1,5-naphthyridin-2-yl]urea.
| Compound Name | 1-cyclopentyl-3-[7-[4-hydroxy-3-(2-methoxyethoxy)phenyl]-1,5-naphthyridin-2-yl]urea |
|---|---|
| PubChem CID | 136628684 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1-cyclopentyl-3-[7-[4-hydroxy-3-(2-methoxyethoxy)phenyl]-1,5-naphthyridin-2-yl]urea |
| SMILES | COCCOc1cc(-c2cnc3ccc(NC(=O)NC4CCCC4)nc3c2)ccc1O |
| InChI | InChI=1S/C23H26N4O4/c1-30-10-11-31-21-13-15(6-8-20(21)28)16-12-19-18(24-14-16)7-9-22(26-19)27-23(29)25-17-4-2-3-5-17/h6-9,12-14,17,28H,2-5,10-11H2,1H3,(H2,25,26,27,29) |
| InChIKey | WBYPZFDVRTWJAJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|