C18H22N6O — CID 144521336
1-[7-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-1,5-naphthyridin-2-yl]-3-(cyclopentylmethyl)urea (PubChem CID 144521336) has the molecular formula C18H22N6O and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-[7-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-1,5-naphthyridin-2-yl]-3-(cyclopentylmethyl)urea.
| Compound Name | 1-[7-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-1,5-naphthyridin-2-yl]-3-(cyclopentylmethyl)urea |
|---|---|
| PubChem CID | 144521336 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 1-[7-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-1,5-naphthyridin-2-yl]-3-(cyclopentylmethyl)urea |
| SMILES | [H]/N=C/C(=C\N)c1cnc2ccc(NC(=O)NCC3CCCC3)nc2c1 |
| InChI | InChI=1S/C18H22N6O/c19-8-14(9-20)13-7-16-15(21-11-13)5-6-17(23-16)24-18(25)22-10-12-3-1-2-4-12/h5-9,11-12,19H,1-4,10,20H2,(H2,22,23,24,25)/b14-9+,19-8+ |
| InChIKey | NKCWQPWNEBWVNO-VHVFTYPWSA-N |
| XLogP | 2.89 |
| TPSA | 116.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|