C20H23N5O2S — CID 88994187
3-cyclopentyl-1-[3-(5-propan-2-ylfuran-2-yl)pyrido[2,3-b]pyrazin-6-yl]-1-sulfanylurea (PubChem CID 88994187) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is 3-cyclopentyl-1-[3-(5-propan-2-ylfuran-2-yl)pyrido[2,3-b]pyrazin-6-yl]-1-sulfanylurea.
| Compound Name | 3-cyclopentyl-1-[3-(5-propan-2-ylfuran-2-yl)pyrido[2,3-b]pyrazin-6-yl]-1-sulfanylurea |
|---|---|
| PubChem CID | 88994187 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 3-cyclopentyl-1-[3-(5-propan-2-ylfuran-2-yl)pyrido[2,3-b]pyrazin-6-yl]-1-sulfanylurea |
| SMILES | CC(C)c1ccc(-c2cnc3ccc(N(S)C(=O)NC4CCCC4)nc3n2)o1 |
| InChI | InChI=1S/C20H23N5O2S/c1-12(2)16-8-9-17(27-16)15-11-21-14-7-10-18(24-19(14)23-15)25(28)20(26)22-13-5-3-4-6-13/h7-13,28H,3-6H2,1-2H3,(H,22,26) |
| InChIKey | PZYNXOQZGCPYDY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|