C6H9N5S2 — CID 175023475
1-prop-2-enyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)thiourea (PubChem CID 175023475) has the molecular formula C6H9N5S2 and a molecular weight of 215.31 g/mol. Its IUPAC name is 1-prop-2-enyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)thiourea.
| Compound Name | 1-prop-2-enyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)thiourea |
|---|---|
| PubChem CID | 175023475 |
| Molecular Formula | C6H9N5S2 |
| Molecular Weight | 215.31 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 1-prop-2-enyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)thiourea |
| SMILES | C=CCNC(=S)Nc1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C6H9N5S2/c1-2-3-7-5(12)8-4-9-6(13)11-10-4/h2H,1,3H2,(H4,7,8,9,10,11,12,13) |
| InChIKey | SRHNICGIKFQJTA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|