C10H11N5S3 — CID 4056566
1-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]-3-prop-2-enylthiourea (PubChem CID 4056566) has the molecular formula C10H11N5S3 and a molecular weight of 297.43 g/mol. Its IUPAC name is 1-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]-3-prop-2-enylthiourea.
| Compound Name | 1-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 4056566 |
| Molecular Formula | C10H11N5S3 |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 1-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1nc(-c2csc(N)n2)cs1 |
| InChI | InChI=1S/C10H11N5S3/c1-2-3-12-9(16)15-10-14-7(5-18-10)6-4-17-8(11)13-6/h2,4-5H,1,3H2,(H2,11,13)(H2,12,14,15,16) |
| InChIKey | IYCIISGXTVYZIP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|