C9H16N4S2 — CID 108780363
1-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-3-ethylthiourea (PubChem CID 108780363) has the molecular formula C9H16N4S2 and a molecular weight of 244.39 g/mol. Its IUPAC name is 1-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-3-ethylthiourea.
| Compound Name | 1-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-3-ethylthiourea |
|---|---|
| PubChem CID | 108780363 |
| Molecular Formula | C9H16N4S2 |
| Molecular Weight | 244.39 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1nc(CN(C)C)cs1 |
| InChI | InChI=1S/C9H16N4S2/c1-4-10-8(14)12-9-11-7(6-15-9)5-13(2)3/h6H,4-5H2,1-3H3,(H2,10,11,12,14) |
| InChIKey | DQWGZSUEUJXNAI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|