C16H12Cl4N4O3S — CID 108750661
N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 108750661) has the molecular formula C16H12Cl4N4O3S and a molecular weight of 482.18 g/mol. Its IUPAC name is N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 108750661 |
| Molecular Formula | C16H12Cl4N4O3S |
| Molecular Weight | 482.18 g/mol |
| Exact Mass | 479.94 |
| IUPAC Name | N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | CN(C)Cc1csc(NC(=O)CN2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)n1 |
| InChI | InChI=1S/C16H12Cl4N4O3S/c1-23(2)3-6-5-28-16(21-6)22-7(25)4-24-14(26)8-9(15(24)27)11(18)13(20)12(19)10(8)17/h5H,3-4H2,1-2H3,(H,21,22,25) |
| InChIKey | IIRLARWIHZBMKH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.18 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|