C14H16N4O4S — CID 108726626
N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-2-(4-nitrophenoxy)acetamide (PubChem CID 108726626) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 108726626 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-2-(4-nitrophenoxy)acetamide |
| SMILES | CN(C)Cc1csc(NC(=O)COc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C14H16N4O4S/c1-17(2)7-10-9-23-14(15-10)16-13(19)8-22-12-5-3-11(4-6-12)18(20)21/h3-6,9H,7-8H2,1-2H3,(H,15,16,19) |
| InChIKey | YSHBDCBWRFSRLS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|