About N-[(2-hydrazinyl-1,3-thiazol-4-yl)methyl]-N-methylethanamine
N-[(2-hydrazinyl-1,3-thiazol-4-yl)methyl]-N-methylethanamine (PubChem CID 130552869) has the molecular formula C7H14N4S
and a molecular weight of 186.28 g/mol. Its IUPAC name is N-[(2-hydrazinyl-1,3-thiazol-4-yl)methyl]-N-methylethanamine.
Molecular Properties
| Compound Name | N-[(2-hydrazinyl-1,3-thiazol-4-yl)methyl]-N-methylethanamine |
| PubChem CID | 130552869 |
| Molecular Formula | C7H14N4S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | N-[(2-hydrazinyl-1,3-thiazol-4-yl)methyl]-N-methylethanamine |
| SMILES | CCN(C)Cc1csc(NN)n1 |
| InChI | InChI=1S/C7H14N4S/c1-3-11(2)4-6-5-12-7(9-6)10-8/h5H,3-4,8H2,1-2H3,(H,9,10) |
| InChIKey | YPEUUQWRRLWTNK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-hydrazinyl-1,3-thiazol-4-yl)methyl]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-hydrazinyl-1,3-thiazol-4-yl)methyl]-N-methylethanamine?
The IUPAC name of N-[(2-hydrazinyl-1,3-thiazol-4-yl)methyl]-N-methylethanamine (CID 130552869) is N-[(2-hydrazinyl-1,3-thiazol-4-yl)methyl]-N-methylethanamine.
What is the SMILES notation for N-[(2-hydrazinyl-1,3-thiazol-4-yl)methyl]-N-methylethanamine?
The canonical SMILES for N-[(2-hydrazinyl-1,3-thiazol-4-yl)methyl]-N-methylethanamine is CCN(C)Cc1csc(NN)n1.
What is the InChIKey of N-[(2-hydrazinyl-1,3-thiazol-4-yl)methyl]-N-methylethanamine?
The InChIKey is YPEUUQWRRLWTNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4S/c1-3-11(2)4-6-5-12-7(9-6)10-8/h5H,3-4,8H2,1-2H3,(H,9,10).
What are the key properties of N-[(2-hydrazinyl-1,3-thiazol-4-yl)methyl]-N-methylethanamine?
N-[(2-hydrazinyl-1,3-thiazol-4-yl)methyl]-N-methylethanamine has a molecular weight of 186.28 g/mol, XLogP of 0.88, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-hydrazinyl-1,3-thiazol-4-yl)methyl]-N-methylethanamine is sourced from PubChem (CID 130552869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).