C6H13N5S — CID 80614289
N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methylethanamine (PubChem CID 80614289) has the molecular formula C6H13N5S and a molecular weight of 187.27 g/mol. Its IUPAC name is N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methylethanamine.
| Compound Name | N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methylethanamine |
|---|---|
| PubChem CID | 80614289 |
| Molecular Formula | C6H13N5S |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methylethanamine |
| SMILES | CCN(C)Cc1nnc(NN)s1 |
| InChI | InChI=1S/C6H13N5S/c1-3-11(2)4-5-9-10-6(8-7)12-5/h3-4,7H2,1-2H3,(H,8,10) |
| InChIKey | ROGNWURRIGJIBD-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|