C8H16N6OS — CID 106918004
3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-methylpropanamide (PubChem CID 106918004) has the molecular formula C8H16N6OS and a molecular weight of 244.32 g/mol. Its IUPAC name is 3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-methylpropanamide.
| Compound Name | 3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 106918004 |
| Molecular Formula | C8H16N6OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-methylpropanamide |
| SMILES | CNC(=O)CCN(C)Cc1nnc(NN)s1 |
| InChI | InChI=1S/C8H16N6OS/c1-10-6(15)3-4-14(2)5-7-12-13-8(11-9)16-7/h3-5,9H2,1-2H3,(H,10,15)(H,11,13) |
| InChIKey | RFVNEPFKSRPIOF-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|