C8H14N6S — CID 80614579
3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl-methylamino]-2-methylpropanenitrile (PubChem CID 80614579) has the molecular formula C8H14N6S and a molecular weight of 226.31 g/mol. Its IUPAC name is 3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl-methylamino]-2-methylpropanenitrile.
| Compound Name | 3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl-methylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 80614579 |
| Molecular Formula | C8H14N6S |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl-methylamino]-2-methylpropanenitrile |
| SMILES | CC(C#N)CN(C)Cc1nnc(NN)s1 |
| InChI | InChI=1S/C8H14N6S/c1-6(3-9)4-14(2)5-7-12-13-8(11-10)15-7/h6H,4-5,10H2,1-2H3,(H,11,13) |
| InChIKey | INXZDSNYHNKJQV-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|