C9H12BrN5S2 — CID 80613669
1-(4-bromothiophen-2-yl)-N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methylmethanamine (PubChem CID 80613669) has the molecular formula C9H12BrN5S2 and a molecular weight of 334.27 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methylmethanamine.
| Compound Name | 1-(4-bromothiophen-2-yl)-N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 80613669 |
| Molecular Formula | C9H12BrN5S2 |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methylmethanamine |
| SMILES | CN(Cc1cc(Br)cs1)Cc1nnc(NN)s1 |
| InChI | InChI=1S/C9H12BrN5S2/c1-15(3-7-2-6(10)5-16-7)4-8-13-14-9(12-11)17-8/h2,5H,3-4,11H2,1H3,(H,12,14) |
| InChIKey | AUTWKSRDYYHTAD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|