C9H19N5S2 — CID 112664455
N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methyl-1-methylsulfanylbutan-2-amine (PubChem CID 112664455) has the molecular formula C9H19N5S2 and a molecular weight of 261.42 g/mol. Its IUPAC name is N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methyl-1-methylsulfanylbutan-2-amine.
| Compound Name | N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methyl-1-methylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 112664455 |
| Molecular Formula | C9H19N5S2 |
| Molecular Weight | 261.42 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methyl-1-methylsulfanylbutan-2-amine |
| SMILES | CCC(CSC)N(C)Cc1nnc(NN)s1 |
| InChI | InChI=1S/C9H19N5S2/c1-4-7(6-15-3)14(2)5-8-12-13-9(11-10)16-8/h7H,4-6,10H2,1-3H3,(H,11,13) |
| InChIKey | WNULZTZUFVWVDD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|