C10H21N5O2S — CID 80613771
N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-1-methoxy-N-(2-methoxyethyl)propan-2-amine (PubChem CID 80613771) has the molecular formula C10H21N5O2S and a molecular weight of 275.38 g/mol. Its IUPAC name is N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-1-methoxy-N-(2-methoxyethyl)propan-2-amine.
| Compound Name | N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-1-methoxy-N-(2-methoxyethyl)propan-2-amine |
|---|---|
| PubChem CID | 80613771 |
| Molecular Formula | C10H21N5O2S |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-1-methoxy-N-(2-methoxyethyl)propan-2-amine |
| SMILES | COCCN(Cc1nnc(NN)s1)C(C)COC |
| InChI | InChI=1S/C10H21N5O2S/c1-8(7-17-3)15(4-5-16-2)6-9-13-14-10(12-11)18-9/h8H,4-7,11H2,1-3H3,(H,12,14) |
| InChIKey | NBOCRPYYYCWGHT-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|