C11H23N5OS — CID 80613272
N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-methoxyethyl)pentan-3-amine (PubChem CID 80613272) has the molecular formula C11H23N5OS and a molecular weight of 273.41 g/mol. Its IUPAC name is N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-methoxyethyl)pentan-3-amine.
| Compound Name | N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-methoxyethyl)pentan-3-amine |
|---|---|
| PubChem CID | 80613272 |
| Molecular Formula | C11H23N5OS |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-methoxyethyl)pentan-3-amine |
| SMILES | CCC(CC)N(CCOC)Cc1nnc(NN)s1 |
| InChI | InChI=1S/C11H23N5OS/c1-4-9(5-2)16(6-7-17-3)8-10-14-15-11(13-12)18-10/h9H,4-8,12H2,1-3H3,(H,13,15) |
| InChIKey | GUOFWBMUUHSWAQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|