C11H23N5S — CID 80614479
N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-propan-2-ylpentan-1-amine (PubChem CID 80614479) has the molecular formula C11H23N5S and a molecular weight of 257.41 g/mol. Its IUPAC name is N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-propan-2-ylpentan-1-amine.
| Compound Name | N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-propan-2-ylpentan-1-amine |
|---|---|
| PubChem CID | 80614479 |
| Molecular Formula | C11H23N5S |
| Molecular Weight | 257.41 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-propan-2-ylpentan-1-amine |
| SMILES | CCCCCN(Cc1nnc(NN)s1)C(C)C |
| InChI | InChI=1S/C11H23N5S/c1-4-5-6-7-16(9(2)3)8-10-14-15-11(13-12)17-10/h9H,4-8,12H2,1-3H3,(H,13,15) |
| InChIKey | XLHOBDBAKJMDGY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|