C8H17N5S2 — CID 112664466
N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methyl-1-methylsulfanylpropan-2-amine (PubChem CID 112664466) has the molecular formula C8H17N5S2 and a molecular weight of 247.39 g/mol. Its IUPAC name is N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methyl-1-methylsulfanylpropan-2-amine.
| Compound Name | N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methyl-1-methylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 112664466 |
| Molecular Formula | C8H17N5S2 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N-methyl-1-methylsulfanylpropan-2-amine |
| SMILES | CSCC(C)N(C)Cc1nnc(NN)s1 |
| InChI | InChI=1S/C8H17N5S2/c1-6(5-14-3)13(2)4-7-11-12-8(10-9)15-7/h6H,4-5,9H2,1-3H3,(H,10,12) |
| InChIKey | AXRUXFKQIMRJIY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|