About 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]propan-1-ol
2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]propan-1-ol (PubChem CID 104554428) has the molecular formula C9H18N4OS
and a molecular weight of 230.34 g/mol. Its IUPAC name is 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]propan-1-ol.
Molecular Properties
| Compound Name | 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]propan-1-ol |
| PubChem CID | 104554428 |
| Molecular Formula | C9H18N4OS |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]propan-1-ol |
| SMILES | CCNc1nnc(CN(C)C(C)CO)s1 |
| InChI | InChI=1S/C9H18N4OS/c1-4-10-9-12-11-8(15-9)5-13(3)7(2)6-14/h7,14H,4-6H2,1-3H3,(H,10,12) |
| InChIKey | XKJVSIQIRZTZHD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]propan-1-ol?
The IUPAC name of 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]propan-1-ol (CID 104554428) is 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]propan-1-ol.
What is the SMILES notation for 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]propan-1-ol?
The canonical SMILES for 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]propan-1-ol is CCNc1nnc(CN(C)C(C)CO)s1.
What is the InChIKey of 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]propan-1-ol?
The InChIKey is XKJVSIQIRZTZHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4OS/c1-4-10-9-12-11-8(15-9)5-13(3)7(2)6-14/h7,14H,4-6H2,1-3H3,(H,10,12).
What are the key properties of 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]propan-1-ol?
2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]propan-1-ol has a molecular weight of 230.34 g/mol, XLogP of 0.78, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]propan-1-ol is sourced from PubChem (CID 104554428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).