About 5-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]pentan-1-ol
5-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]pentan-1-ol (PubChem CID 107204436) has the molecular formula C11H22N4OS
and a molecular weight of 258.39 g/mol. Its IUPAC name is 5-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]pentan-1-ol.
Molecular Properties
| Compound Name | 5-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]pentan-1-ol |
| PubChem CID | 107204436 |
| Molecular Formula | C11H22N4OS |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 5-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]pentan-1-ol |
| SMILES | CCNc1nnc(CN(C)CCCCCO)s1 |
| InChI | InChI=1S/C11H22N4OS/c1-3-12-11-14-13-10(17-11)9-15(2)7-5-4-6-8-16/h16H,3-9H2,1-2H3,(H,12,14) |
| InChIKey | VUIQLQHIDIHFDI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]pentan-1-ol?
The IUPAC name of 5-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]pentan-1-ol (CID 107204436) is 5-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]pentan-1-ol.
What is the SMILES notation for 5-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]pentan-1-ol?
The canonical SMILES for 5-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]pentan-1-ol is CCNc1nnc(CN(C)CCCCCO)s1.
What is the InChIKey of 5-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]pentan-1-ol?
The InChIKey is VUIQLQHIDIHFDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4OS/c1-3-12-11-14-13-10(17-11)9-15(2)7-5-4-6-8-16/h16H,3-9H2,1-2H3,(H,12,14).
What are the key properties of 5-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]pentan-1-ol?
5-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]pentan-1-ol has a molecular weight of 258.39 g/mol, XLogP of 1.56, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]pentan-1-ol is sourced from PubChem (CID 107204436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).