C11H22N4OS — CID 81074660
5-[[2-ethoxyethyl(methyl)amino]methyl]-N-propyl-1,3,4-thiadiazol-2-amine (PubChem CID 81074660) has the molecular formula C11H22N4OS and a molecular weight of 258.39 g/mol. Its IUPAC name is 5-[[2-ethoxyethyl(methyl)amino]methyl]-N-propyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[[2-ethoxyethyl(methyl)amino]methyl]-N-propyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 81074660 |
| Molecular Formula | C11H22N4OS |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 5-[[2-ethoxyethyl(methyl)amino]methyl]-N-propyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCNc1nnc(CN(C)CCOCC)s1 |
| InChI | InChI=1S/C11H22N4OS/c1-4-6-12-11-14-13-10(17-11)9-15(3)7-8-16-5-2/h4-9H2,1-3H3,(H,12,14) |
| InChIKey | VGNSOSRNWNCKAG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|