C11H23N5O2S — CID 82952358
2-ethoxy-N-(2-ethoxyethyl)-N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]ethanamine (PubChem CID 82952358) has the molecular formula C11H23N5O2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-ethoxy-N-(2-ethoxyethyl)-N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]ethanamine.
| Compound Name | 2-ethoxy-N-(2-ethoxyethyl)-N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 82952358 |
| Molecular Formula | C11H23N5O2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-ethoxy-N-(2-ethoxyethyl)-N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]ethanamine |
| SMILES | CCOCCN(CCOCC)Cc1nnc(NN)s1 |
| InChI | InChI=1S/C11H23N5O2S/c1-3-17-7-5-16(6-8-18-4-2)9-10-14-15-11(13-12)19-10/h3-9,12H2,1-2H3,(H,13,15) |
| InChIKey | RSABDFAYPJULBS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|