About N-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-N-ethyl-1-methoxypropan-2-amine
N-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-N-ethyl-1-methoxypropan-2-amine (PubChem CID 80611577) has the molecular formula C9H16ClN3OS
and a molecular weight of 249.77 g/mol. Its IUPAC name is N-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-N-ethyl-1-methoxypropan-2-amine.
Molecular Properties
| Compound Name | N-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-N-ethyl-1-methoxypropan-2-amine |
| PubChem CID | 80611577 |
| Molecular Formula | C9H16ClN3OS |
| Molecular Weight | 249.77 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | N-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-N-ethyl-1-methoxypropan-2-amine |
| SMILES | CCN(Cc1nnc(Cl)s1)C(C)COC |
| InChI | InChI=1S/C9H16ClN3OS/c1-4-13(7(2)6-14-3)5-8-11-12-9(10)15-8/h7H,4-6H2,1-3H3 |
| InChIKey | AIKTYQIVRLIPCY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.77 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-N-ethyl-1-methoxypropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-N-ethyl-1-methoxypropan-2-amine?
The IUPAC name of N-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-N-ethyl-1-methoxypropan-2-amine (CID 80611577) is N-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-N-ethyl-1-methoxypropan-2-amine.
What is the SMILES notation for N-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-N-ethyl-1-methoxypropan-2-amine?
The canonical SMILES for N-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-N-ethyl-1-methoxypropan-2-amine is CCN(Cc1nnc(Cl)s1)C(C)COC.
What is the InChIKey of N-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-N-ethyl-1-methoxypropan-2-amine?
The InChIKey is AIKTYQIVRLIPCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClN3OS/c1-4-13(7(2)6-14-3)5-8-11-12-9(10)15-8/h7H,4-6H2,1-3H3.
What are the key properties of N-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-N-ethyl-1-methoxypropan-2-amine?
N-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-N-ethyl-1-methoxypropan-2-amine has a molecular weight of 249.77 g/mol, XLogP of 2.05, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-N-ethyl-1-methoxypropan-2-amine is sourced from PubChem (CID 80611577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).