About 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-propan-2-ylamino]ethanol
2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-propan-2-ylamino]ethanol (PubChem CID 80611576) has the molecular formula C8H14ClN3OS
and a molecular weight of 235.74 g/mol. Its IUPAC name is 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-propan-2-ylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-propan-2-ylamino]ethanol |
| PubChem CID | 80611576 |
| Molecular Formula | C8H14ClN3OS |
| Molecular Weight | 235.74 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-propan-2-ylamino]ethanol |
| SMILES | CC(C)N(CCO)Cc1nnc(Cl)s1 |
| InChI | InChI=1S/C8H14ClN3OS/c1-6(2)12(3-4-13)5-7-10-11-8(9)14-7/h6,13H,3-5H2,1-2H3 |
| InChIKey | VEMOVMSZDROBFY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.74 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-propan-2-ylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-propan-2-ylamino]ethanol?
The IUPAC name of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-propan-2-ylamino]ethanol (CID 80611576) is 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-propan-2-ylamino]ethanol.
What is the SMILES notation for 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-propan-2-ylamino]ethanol?
The canonical SMILES for 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-propan-2-ylamino]ethanol is CC(C)N(CCO)Cc1nnc(Cl)s1.
What is the InChIKey of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-propan-2-ylamino]ethanol?
The InChIKey is VEMOVMSZDROBFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClN3OS/c1-6(2)12(3-4-13)5-7-10-11-8(9)14-7/h6,13H,3-5H2,1-2H3.
What are the key properties of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-propan-2-ylamino]ethanol?
2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-propan-2-ylamino]ethanol has a molecular weight of 235.74 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-propan-2-ylamino]ethanol is sourced from PubChem (CID 80611576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).