C9H16N2O2 — CID 62020780
2-[1,2-oxazol-4-ylmethyl(propan-2-yl)amino]ethanol (PubChem CID 62020780) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-[1,2-oxazol-4-ylmethyl(propan-2-yl)amino]ethanol.
| Compound Name | 2-[1,2-oxazol-4-ylmethyl(propan-2-yl)amino]ethanol |
|---|---|
| PubChem CID | 62020780 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 2-[1,2-oxazol-4-ylmethyl(propan-2-yl)amino]ethanol |
| SMILES | CC(C)N(CCO)Cc1cnoc1 |
| InChI | InChI=1S/C9H16N2O2/c1-8(2)11(3-4-12)6-9-5-10-13-7-9/h5,7-8,12H,3-4,6H2,1-2H3 |
| InChIKey | LQTLVSPAMRZQQX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |