C11H20N4O — CID 62246484
2-[(6-hydrazinyl-3-pyridinyl)methyl-propan-2-ylamino]ethanol (PubChem CID 62246484) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-[(6-hydrazinyl-3-pyridinyl)methyl-propan-2-ylamino]ethanol.
| Compound Name | 2-[(6-hydrazinyl-3-pyridinyl)methyl-propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 62246484 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2-[(6-hydrazinyl-3-pyridinyl)methyl-propan-2-ylamino]ethanol |
| SMILES | CC(C)N(CCO)Cc1ccc(NN)nc1 |
| InChI | InChI=1S/C11H20N4O/c1-9(2)15(5-6-16)8-10-3-4-11(14-12)13-7-10/h3-4,7,9,16H,5-6,8,12H2,1-2H3,(H,13,14) |
| InChIKey | QUVFGJLNQRSFAJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|