C9H15N5S — CID 79765526
3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-methylamino]-2-methylpropanenitrile (PubChem CID 79765526) has the molecular formula C9H15N5S and a molecular weight of 225.32 g/mol. Its IUPAC name is 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-methylamino]-2-methylpropanenitrile.
| Compound Name | 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-methylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 79765526 |
| Molecular Formula | C9H15N5S |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-methylamino]-2-methylpropanenitrile |
| SMILES | CC(C#N)CN(C)Cc1cnc(NN)s1 |
| InChI | InChI=1S/C9H15N5S/c1-7(3-10)5-14(2)6-8-4-12-9(13-11)15-8/h4,7H,5-6,11H2,1-2H3,(H,12,13) |
| InChIKey | PARJZBUSUYRIDA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|