C9H15F3N4S — CID 79764246
N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N-(2,2,2-trifluoroethyl)propan-2-amine (PubChem CID 79764246) has the molecular formula C9H15F3N4S and a molecular weight of 268.31 g/mol. Its IUPAC name is N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N-(2,2,2-trifluoroethyl)propan-2-amine.
| Compound Name | N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N-(2,2,2-trifluoroethyl)propan-2-amine |
|---|---|
| PubChem CID | 79764246 |
| Molecular Formula | C9H15F3N4S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N-(2,2,2-trifluoroethyl)propan-2-amine |
| SMILES | CC(C)N(Cc1cnc(NN)s1)CC(F)(F)F |
| InChI | InChI=1S/C9H15F3N4S/c1-6(2)16(5-9(10,11)12)4-7-3-14-8(15-13)17-7/h3,6H,4-5,13H2,1-2H3,(H,14,15) |
| InChIKey | JGFXJTJGQVWVBS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|