C7H11F3N4S — CID 79775000
2,2,2-trifluoro-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N-methylethanamine (PubChem CID 79775000) has the molecular formula C7H11F3N4S and a molecular weight of 240.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N-methylethanamine.
| Compound Name | 2,2,2-trifluoro-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N-methylethanamine |
|---|---|
| PubChem CID | 79775000 |
| Molecular Formula | C7H11F3N4S |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N-methylethanamine |
| SMILES | CN(Cc1cnc(NN)s1)CC(F)(F)F |
| InChI | InChI=1S/C7H11F3N4S/c1-14(4-7(8,9)10)3-5-2-12-6(13-11)15-5/h2H,3-4,11H2,1H3,(H,12,13) |
| InChIKey | XMUIFQFTTLPZMM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|