C13H13N3S2 — CID 4763317
1-(4-phenyl-1,3-thiazol-2-yl)-3-prop-2-enylthiourea (PubChem CID 4763317) has the molecular formula C13H13N3S2 and a molecular weight of 275.40 g/mol. Its IUPAC name is 1-(4-phenyl-1,3-thiazol-2-yl)-3-prop-2-enylthiourea.
| Compound Name | 1-(4-phenyl-1,3-thiazol-2-yl)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 4763317 |
| Molecular Formula | C13H13N3S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 1-(4-phenyl-1,3-thiazol-2-yl)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C13H13N3S2/c1-2-8-14-12(17)16-13-15-11(9-18-13)10-6-4-3-5-7-10/h2-7,9H,1,8H2,(H2,14,15,16,17) |
| InChIKey | ABLBIGLYMWJTAS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|