C16H17N3O4S — CID 166682037
[(2S)-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]-3-prop-2-enoxypropan-2-yl]carbamic acid (PubChem CID 166682037) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]-3-prop-2-enoxypropan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]-3-prop-2-enoxypropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 166682037 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | [(2S)-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]-3-prop-2-enoxypropan-2-yl]carbamic acid |
| SMILES | C=CCOC[C@H](NC(=O)O)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H17N3O4S/c1-2-8-23-9-12(18-16(21)22)14(20)19-15-17-13(10-24-15)11-6-4-3-5-7-11/h2-7,10,12,18H,1,8-9H2,(H,21,22)(H,17,19,20)/t12-/m0/s1 |
| InChIKey | NOURWSLBVZNNTO-LBPRGKRZSA-N |
| XLogP | 2.59 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|