C23H21N5OS2 — CID 4037372
2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)propanamide (PubChem CID 4037372) has the molecular formula C23H21N5OS2 and a molecular weight of 447.59 g/mol. Its IUPAC name is 2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 4037372 |
| Molecular Formula | C23H21N5OS2 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)propanamide |
| SMILES | C=CCn1c(SC(C)C(=O)Nc2nc(-c3ccccc3)cs2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C23H21N5OS2/c1-3-14-28-20(18-12-8-5-9-13-18)26-27-23(28)31-16(2)21(29)25-22-24-19(15-30-22)17-10-6-4-7-11-17/h3-13,15-16H,1,14H2,2H3,(H,24,25,29) |
| InChIKey | SESOLQPWHPGYHI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|