C13H14N4S2 — CID 108784318
1-prop-2-enyl-3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]thiourea (PubChem CID 108784318) has the molecular formula C13H14N4S2 and a molecular weight of 290.42 g/mol. Its IUPAC name is 1-prop-2-enyl-3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]thiourea.
| Compound Name | 1-prop-2-enyl-3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 108784318 |
| Molecular Formula | C13H14N4S2 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 1-prop-2-enyl-3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]thiourea |
| SMILES | C=CCNC(=S)NCc1csc(-c2ccccn2)n1 |
| InChI | InChI=1S/C13H14N4S2/c1-2-6-15-13(18)16-8-10-9-19-12(17-10)11-5-3-4-7-14-11/h2-5,7,9H,1,6,8H2,(H2,15,16,18) |
| InChIKey | RLGJKCITOICRKN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|