C17H24N4O3 — CID 27243525
N-(2,6-dimethylphenyl)-2-[methyl-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]amino]acetamide (PubChem CID 27243525) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[methyl-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]amino]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[methyl-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 27243525 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[methyl-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]amino]acetamide |
| SMILES | C=CCNC(=O)NC(=O)CN(C)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C17H24N4O3/c1-5-9-18-17(24)20-15(23)11-21(4)10-14(22)19-16-12(2)7-6-8-13(16)3/h5-8H,1,9-11H2,2-4H3,(H,19,22)(H2,18,20,23,24) |
| InChIKey | WLKXAUHNFWTMKX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|