C17H26N4O4 — CID 17462930
N-(2,6-dimethylphenyl)-2-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]-methylamino]acetamide (PubChem CID 17462930) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]-methylamino]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 17462930 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]-methylamino]acetamide |
| SMILES | COCCNC(=O)NC(=O)CN(C)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C17H26N4O4/c1-12-6-5-7-13(2)16(12)19-14(22)10-21(3)11-15(23)20-17(24)18-8-9-25-4/h5-7H,8-11H2,1-4H3,(H,19,22)(H2,18,20,23,24) |
| InChIKey | LFEGRHHHWONYDR-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|