About 6-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-N-prop-2-enylpyridine-3-carboxamide
6-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 133334436) has the molecular formula C20H24N4O2
and a molecular weight of 352.44 g/mol. Its IUPAC name is 6-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-N-prop-2-enylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-N-prop-2-enylpyridine-3-carboxamide |
| PubChem CID | 133334436 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 6-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(N(C)CC(=O)Nc2c(C)cccc2C)nc1 |
| InChI | InChI=1S/C20H24N4O2/c1-5-11-21-20(26)16-9-10-17(22-12-16)24(4)13-18(25)23-19-14(2)7-6-8-15(19)3/h5-10,12H,1,11,13H2,2-4H3,(H,21,26)(H,23,25) |
| InChIKey | GQBAJJBLTPRNAH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-N-prop-2-enylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-N-prop-2-enylpyridine-3-carboxamide?
The IUPAC name of 6-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-N-prop-2-enylpyridine-3-carboxamide (CID 133334436) is 6-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-N-prop-2-enylpyridine-3-carboxamide.
What is the SMILES notation for 6-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-N-prop-2-enylpyridine-3-carboxamide?
The canonical SMILES for 6-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-N-prop-2-enylpyridine-3-carboxamide is C=CCNC(=O)c1ccc(N(C)CC(=O)Nc2c(C)cccc2C)nc1.
What is the InChIKey of 6-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-N-prop-2-enylpyridine-3-carboxamide?
The InChIKey is GQBAJJBLTPRNAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O2/c1-5-11-21-20(26)16-9-10-17(22-12-16)24(4)13-18(25)23-19-14(2)7-6-8-15(19)3/h5-10,12H,1,11,13H2,2-4H3,(H,21,26)(H,23,25).
What are the key properties of 6-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-N-prop-2-enylpyridine-3-carboxamide?
6-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-N-prop-2-enylpyridine-3-carboxamide has a molecular weight of 352.44 g/mol, XLogP of 2.69, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]-N-prop-2-enylpyridine-3-carboxamide is sourced from PubChem (CID 133334436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).