C36H40 — CID 153329326
1-methyl-4-[3,7,12,16-tetramethyl-18-(4-methylphenyl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]benzene (PubChem CID 153329326) has the molecular formula C36H40 and a molecular weight of 472.72 g/mol. Its IUPAC name is 1-methyl-4-[3,7,12,16-tetramethyl-18-(4-methylphenyl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]benzene.
| Compound Name | 1-methyl-4-[3,7,12,16-tetramethyl-18-(4-methylphenyl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]benzene |
|---|---|
| PubChem CID | 153329326 |
| Molecular Formula | C36H40 |
| Molecular Weight | 472.72 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | 1-methyl-4-[3,7,12,16-tetramethyl-18-(4-methylphenyl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]benzene |
| SMILES | CC(C=CC=C(C)C=Cc1ccc(C)cc1)=CC=CC=C(C)C=CC=C(C)C=Cc1ccc(C)cc1 |
| InChI | InChI=1S/C36H40/c1-29(13-9-15-31(3)17-23-35-25-19-33(5)20-26-35)11-7-8-12-30(2)14-10-16-32(4)18-24-36-27-21-34(6)22-28-36/h7-28H,1-6H3 |
| InChIKey | NHTFORJBEDIGBW-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.72 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|