C40H44S2 — CID 102207836
[4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E,21E)-5,9,14,18-tetramethyl-22-[4-(sulfanylmethyl)phenyl]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaenyl]phenyl]methanethiol (PubChem CID 102207836) has the molecular formula C40H44S2 and a molecular weight of 588.93 g/mol. Its IUPAC name is [4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E,21E)-5,9,14,18-tetramethyl-22-[4-(sulfanylmethyl)phenyl]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaenyl]phenyl]methanethiol.
| Compound Name | [4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E,21E)-5,9,14,18-tetramethyl-22-[4-(sulfanylmethyl)phenyl]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaenyl]phenyl]methanethiol |
|---|---|
| PubChem CID | 102207836 |
| Molecular Formula | C40H44S2 |
| Molecular Weight | 588.93 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | [4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E,21E)-5,9,14,18-tetramethyl-22-[4-(sulfanylmethyl)phenyl]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaenyl]phenyl]methanethiol |
| SMILES | CC(/C=C/C=C(C)/C=C/C=C/c1ccc(CS)cc1)=C\C=C\C=C(C)\C=C\C=C(C)\C=C\C=C\c1ccc(CS)cc1 |
| InChI | InChI=1S/C40H44S2/c1-33(17-11-19-35(3)15-7-9-21-37-23-27-39(31-41)28-24-37)13-5-6-14-34(2)18-12-20-36(4)16-8-10-22-38-25-29-40(32-42)30-26-38/h5-30,41-42H,31-32H2,1-4H3/b6-5+,15-7+,16-8+,17-11+,18-12+,21-9+,22-10+,33-13+,34-14+,35-19+,36-20+ |
| InChIKey | XHCOLTNIFKEDDL-WLCDYMSESA-N |
| XLogP | 11.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.93 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|