C24H26O — CID 173308644
1,8-bis(4-ethylphenyl)octa-1,3,5,7-tetraen-2-ol (PubChem CID 173308644) has the molecular formula C24H26O and a molecular weight of 330.47 g/mol. Its IUPAC name is 1,8-bis(4-ethylphenyl)octa-1,3,5,7-tetraen-2-ol.
| Compound Name | 1,8-bis(4-ethylphenyl)octa-1,3,5,7-tetraen-2-ol |
|---|---|
| PubChem CID | 173308644 |
| Molecular Formula | C24H26O |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 1,8-bis(4-ethylphenyl)octa-1,3,5,7-tetraen-2-ol |
| SMILES | CCc1ccc(C=CC=CC=CC(O)=Cc2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C24H26O/c1-3-20-11-15-22(16-12-20)9-7-5-6-8-10-24(25)19-23-17-13-21(4-2)14-18-23/h5-19,25H,3-4H2,1-2H3 |
| InChIKey | VMDQXNIUXABMDZ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|