C22H22O2 — CID 174676185
but-1-enylbenzene;3-phenylbenzene-1,2-diol (PubChem CID 174676185) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is but-1-enylbenzene;3-phenylbenzene-1,2-diol.
| Compound Name | but-1-enylbenzene;3-phenylbenzene-1,2-diol |
|---|---|
| PubChem CID | 174676185 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | but-1-enylbenzene;3-phenylbenzene-1,2-diol |
| SMILES | CCC=Cc1ccccc1.Oc1cccc(-c2ccccc2)c1O |
| InChI | InChI=1S/C12H10O2.C10H12/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9;1-2-3-7-10-8-5-4-6-9-10/h1-8,13-14H;3-9H,2H2,1H3 |
| InChIKey | AHQGNGFVHMQJGZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|