About 1,2-diphenylethenylbenzene;quinoxaline
1,2-diphenylethenylbenzene;quinoxaline (PubChem CID 175322673) has the molecular formula C28H22N2
and a molecular weight of 386.50 g/mol. Its IUPAC name is 1,2-diphenylethenylbenzene;quinoxaline.
Molecular Properties
| Compound Name | 1,2-diphenylethenylbenzene;quinoxaline |
| PubChem CID | 175322673 |
| Molecular Formula | C28H22N2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1,2-diphenylethenylbenzene;quinoxaline |
| SMILES | C(=C(c1ccccc1)c1ccccc1)c1ccccc1.c1ccc2nccnc2c1 |
| InChI | InChI=1S/C20H16.C8H6N2/c1-4-10-17(11-5-1)16-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19;1-2-4-8-7(3-1)9-5-6-10-8/h1-16H;1-6H |
| InChIKey | ACKLVTFOMIBOBL-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diphenylethenylbenzene;quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenylethenylbenzene;quinoxaline?
The IUPAC name of 1,2-diphenylethenylbenzene;quinoxaline (CID 175322673) is 1,2-diphenylethenylbenzene;quinoxaline.
What is the SMILES notation for 1,2-diphenylethenylbenzene;quinoxaline?
The canonical SMILES for 1,2-diphenylethenylbenzene;quinoxaline is C(=C(c1ccccc1)c1ccccc1)c1ccccc1.c1ccc2nccnc2c1.
What is the InChIKey of 1,2-diphenylethenylbenzene;quinoxaline?
The InChIKey is ACKLVTFOMIBOBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16.C8H6N2/c1-4-10-17(11-5-1)16-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19;1-2-4-8-7(3-1)9-5-6-10-8/h1-16H;1-6H.
What are the key properties of 1,2-diphenylethenylbenzene;quinoxaline?
1,2-diphenylethenylbenzene;quinoxaline has a molecular weight of 386.50 g/mol, XLogP of 6.91, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenylethenylbenzene;quinoxaline is sourced from PubChem (CID 175322673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).