C16H13F5N2O — CID 2387889
(E)-2-cyano-N-cyclohexyl-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide (PubChem CID 2387889) has the molecular formula C16H13F5N2O and a molecular weight of 344.28 g/mol. Its IUPAC name is (E)-2-cyano-N-cyclohexyl-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-cyclohexyl-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2387889 |
| Molecular Formula | C16H13F5N2O |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (E)-2-cyano-N-cyclohexyl-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1c(F)c(F)c(F)c(F)c1F)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H13F5N2O/c17-11-10(12(18)14(20)15(21)13(11)19)6-8(7-22)16(24)23-9-4-2-1-3-5-9/h6,9H,1-5H2,(H,23,24)/b8-6+ |
| InChIKey | HMCAVRGIRWUPRY-SOFGYWHQSA-N |
| XLogP | 3.74 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|