C14H14Br2N2O2 — CID 92962211
(Z)-2-cyano-N-cyclohexyl-3-(4,5-dibromofuran-2-yl)prop-2-enamide (PubChem CID 92962211) has the molecular formula C14H14Br2N2O2 and a molecular weight of 402.09 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclohexyl-3-(4,5-dibromofuran-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclohexyl-3-(4,5-dibromofuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 92962211 |
| Molecular Formula | C14H14Br2N2O2 |
| Molecular Weight | 402.09 g/mol |
| Exact Mass | 399.94 |
| IUPAC Name | (Z)-2-cyano-N-cyclohexyl-3-(4,5-dibromofuran-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C/c1cc(Br)c(Br)o1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H14Br2N2O2/c15-12-7-11(20-13(12)16)6-9(8-17)14(19)18-10-4-2-1-3-5-10/h6-7,10H,1-5H2,(H,18,19)/b9-6- |
| InChIKey | VPJVFVGVLYHZQT-TWGQIWQCSA-N |
| XLogP | 4.16 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.09 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|