C22H21IN2O2 — CID 126197199
(Z)-2-cyano-N-cyclopentyl-3-[2-[(4-iodophenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 126197199) has the molecular formula C22H21IN2O2 and a molecular weight of 472.33 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclopentyl-3-[2-[(4-iodophenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclopentyl-3-[2-[(4-iodophenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126197199 |
| Molecular Formula | C22H21IN2O2 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | (Z)-2-cyano-N-cyclopentyl-3-[2-[(4-iodophenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | N#C/C(=C/c1ccccc1OCc1ccc(I)cc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C22H21IN2O2/c23-19-11-9-16(10-12-19)15-27-21-8-4-1-5-17(21)13-18(14-24)22(26)25-20-6-2-3-7-20/h1,4-5,8-13,20H,2-3,6-7,15H2,(H,25,26)/b18-13- |
| InChIKey | CXNOFVOIYYTAKS-AQTBWJFISA-N |
| XLogP | 4.84 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|