C19H14ClFN2O — CID 726876
2-[[5-[(2-chloro-4-fluorophenoxy)methyl]-2,4-dimethylphenyl]methylidene]propanedinitrile (PubChem CID 726876) has the molecular formula C19H14ClFN2O and a molecular weight of 340.79 g/mol. Its IUPAC name is 2-[[5-[(2-chloro-4-fluorophenoxy)methyl]-2,4-dimethylphenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[5-[(2-chloro-4-fluorophenoxy)methyl]-2,4-dimethylphenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 726876 |
| Molecular Formula | C19H14ClFN2O |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-[[5-[(2-chloro-4-fluorophenoxy)methyl]-2,4-dimethylphenyl]methylidene]propanedinitrile |
| SMILES | Cc1cc(C)c(COc2ccc(F)cc2Cl)cc1C=C(C#N)C#N |
| InChI | InChI=1S/C19H14ClFN2O/c1-12-5-13(2)16(7-15(12)6-14(9-22)10-23)11-24-19-4-3-17(21)8-18(19)20/h3-8H,11H2,1-2H3 |
| InChIKey | CQWSQGKLFYOTJT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|