C19H16ClFN2OS — CID 6004661
(E)-3-[3-[(2-chloro-4-fluorophenoxy)methyl]-2,5-dimethylphenyl]-2-cyanoprop-2-enethioamide (PubChem CID 6004661) has the molecular formula C19H16ClFN2OS and a molecular weight of 374.87 g/mol. Its IUPAC name is (E)-3-[3-[(2-chloro-4-fluorophenoxy)methyl]-2,5-dimethylphenyl]-2-cyanoprop-2-enethioamide.
| Compound Name | (E)-3-[3-[(2-chloro-4-fluorophenoxy)methyl]-2,5-dimethylphenyl]-2-cyanoprop-2-enethioamide |
|---|---|
| PubChem CID | 6004661 |
| Molecular Formula | C19H16ClFN2OS |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | (E)-3-[3-[(2-chloro-4-fluorophenoxy)methyl]-2,5-dimethylphenyl]-2-cyanoprop-2-enethioamide |
| SMILES | Cc1cc(/C=C(\C#N)C(N)=S)c(C)c(COc2ccc(F)cc2Cl)c1 |
| InChI | InChI=1S/C19H16ClFN2OS/c1-11-5-13(7-14(9-22)19(23)25)12(2)15(6-11)10-24-18-4-3-16(21)8-17(18)20/h3-8H,10H2,1-2H3,(H2,23,25)/b14-7+ |
| InChIKey | APQDCKRDFNUEAU-VGOFMYFVSA-N |
| XLogP | 4.87 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|