C23H24ClNO3 — CID 3582413
propan-2-yl 3-[3-[(4-chloro-2-methylphenoxy)methyl]-2,5-dimethylphenyl]-2-cyanoprop-2-enoate (PubChem CID 3582413) has the molecular formula C23H24ClNO3 and a molecular weight of 397.90 g/mol. Its IUPAC name is propan-2-yl 3-[3-[(4-chloro-2-methylphenoxy)methyl]-2,5-dimethylphenyl]-2-cyanoprop-2-enoate.
| Compound Name | propan-2-yl 3-[3-[(4-chloro-2-methylphenoxy)methyl]-2,5-dimethylphenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 3582413 |
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | propan-2-yl 3-[3-[(4-chloro-2-methylphenoxy)methyl]-2,5-dimethylphenyl]-2-cyanoprop-2-enoate |
| SMILES | Cc1cc(C=C(C#N)C(=O)OC(C)C)c(C)c(COc2ccc(Cl)cc2C)c1 |
| InChI | InChI=1S/C23H24ClNO3/c1-14(2)28-23(26)19(12-25)11-18-8-15(3)9-20(17(18)5)13-27-22-7-6-21(24)10-16(22)4/h6-11,14H,13H2,1-5H3 |
| InChIKey | VVCYZMHOYYYNLD-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|