C22H22ClNO3 — CID 4162201
propan-2-yl 3-[3-[(2-chlorophenoxy)methyl]-2,5-dimethylphenyl]-2-cyanoprop-2-enoate (PubChem CID 4162201) has the molecular formula C22H22ClNO3 and a molecular weight of 383.88 g/mol. Its IUPAC name is propan-2-yl 3-[3-[(2-chlorophenoxy)methyl]-2,5-dimethylphenyl]-2-cyanoprop-2-enoate.
| Compound Name | propan-2-yl 3-[3-[(2-chlorophenoxy)methyl]-2,5-dimethylphenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 4162201 |
| Molecular Formula | C22H22ClNO3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | propan-2-yl 3-[3-[(2-chlorophenoxy)methyl]-2,5-dimethylphenyl]-2-cyanoprop-2-enoate |
| SMILES | Cc1cc(C=C(C#N)C(=O)OC(C)C)c(C)c(COc2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H22ClNO3/c1-14(2)27-22(25)18(12-24)11-17-9-15(3)10-19(16(17)4)13-26-21-8-6-5-7-20(21)23/h5-11,14H,13H2,1-4H3 |
| InChIKey | FBODATFTQBECSC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|