C17H18N6O6S — CID 6285525
ethyl (2Z)-2-cyano-2-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]hydrazinylidene]acetate (PubChem CID 6285525) has the molecular formula C17H18N6O6S and a molecular weight of 434.43 g/mol. Its IUPAC name is ethyl (2Z)-2-cyano-2-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]hydrazinylidene]acetate.
| Compound Name | ethyl (2Z)-2-cyano-2-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]hydrazinylidene]acetate |
|---|---|
| PubChem CID | 6285525 |
| Molecular Formula | C17H18N6O6S |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | ethyl (2Z)-2-cyano-2-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(C#N)=N\Nc1ccc(S(=O)(=O)Nc2cc(OC)nc(OC)n2)cc1 |
| InChI | InChI=1S/C17H18N6O6S/c1-4-29-16(24)13(10-18)22-21-11-5-7-12(8-6-11)30(25,26)23-14-9-15(27-2)20-17(19-14)28-3/h5-9,21H,4H2,1-3H3,(H,19,20,23)/b22-13- |
| InChIKey | WVYIDARGXWIZKM-XKZIYDEJSA-N |
| XLogP | 1.15 |
| TPSA | 164.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|