C21H27N4NaO3S3 — CID 168747189
sodium [4-[[5-(3,5,5-trimethylhexyl)thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]anilino]methanesulfonate (PubChem CID 168747189) has the molecular formula C21H27N4NaO3S3 and a molecular weight of 502.66 g/mol. Its IUPAC name is sodium [4-[[5-(3,5,5-trimethylhexyl)thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]anilino]methanesulfonate.
| Compound Name | sodium [4-[[5-(3,5,5-trimethylhexyl)thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]anilino]methanesulfonate |
|---|---|
| PubChem CID | 168747189 |
| Molecular Formula | C21H27N4NaO3S3 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | sodium [4-[[5-(3,5,5-trimethylhexyl)thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]anilino]methanesulfonate |
| SMILES | CC(CCc1cc2sc(/N=N/c3ccc(NCS(=O)(=O)[O-])cc3)nc2s1)CC(C)(C)C.[Na+] |
| InChI | InChI=1S/C21H28N4O3S3.Na/c1-14(12-21(2,3)4)5-10-17-11-18-19(29-17)23-20(30-18)25-24-16-8-6-15(7-9-16)22-13-31(26,27)28;/h6-9,11,14,22H,5,10,12-13H2,1-4H3,(H,26,27,28);/q;+1/p-1/b25-24+; |
| InChIKey | PYUPPVFABXQDAY-QREUMGABSA-M |
| XLogP | 3.70 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|